Kohulan / ChEMBL_Structure_Pipeline

ChEMBL database structure pipelines

Geek Repo:Geek Repo

Github PK Tool:Github PK Tool

CI Testing License: MIT

ChEMBL Structure Pipeline

ChEMBL protocols used to standardise and salt strip molecules. First used in ChEMBL 26.

Check the wiki and paper[1] for a detailed description of the different processes.

Installation

From source:

git clone https://github.com/chembl/ChEMBL_Structure_Pipeline.git
pip install ./ChEMBL_Structure_Pipeline

with pip:

pip install chembl_structure_pipeline

with conda:

conda install -c conda-forge chembl_structure_pipeline

Usage

Standardise a compound (info)

from chembl_structure_pipeline import standardizer

o_molblock = """
  Mrv1810 07121910172D          

  4  3  0  0  0  0            999 V2000
   -2.5038    0.4060    0.0000 C   0  0  3  0  0  0  0  0  0  0  0  0
   -2.5038    1.2310    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
   -3.2182   -0.0065    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
   -1.7893   -0.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  4  0  0  0
M  CHG  2   2  -1   3   1
M  END
"""

std_molblock = standardizer.standardize_molblock(o_molblock)

Note Using SMILES:

from chembl_structure_pipeline import standardizer

SMILES = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
std_smiles = standardizer.standardize_molblock_from_smiles(SMILES, get_smiles=True)

Get the parent compound (info)

from chembl_structure_pipeline import standardizer

o_molblock = """
  Mrv1810 07121910262D          

  3  1  0  0  0  0            999 V2000
   -5.2331    1.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5186    1.5178    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
   -2.8647    1.5789    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
M  CHG  2   2   1   3  -1
M  END
"""

parent_molblock, _ = standardizer.get_parent_molblock(o_molblock)

Note Using SMILES:

from chembl_structure_pipeline import standardizer

SMILES = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
parent_smiles = standardizer.get_parent_mol_from_smiles(SMILES, get_smiles=True)

Check a compound (info)

The checker assesses the quality of a structure. It highlights specific features or issues in the structure that may need to be revised. Together with the description of the issue, the checker process returns a penalty score (between 0-9) which reflects the seriousness of the issue (the higher the score, the more critical is the issue)

from chembl_structure_pipeline import checker

o_molblock = """ 
  Mrv1810 02151908462D           
 
  4  3  0  0  0  0            999 V2000 
    2.2321    4.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.0023    4.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.4117    4.5059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    1.9568    3.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  1  0  0  0 
  1  3  1  0  0  0  0 
  1  4  1  0  0  0  0 
M  END 
"""

issues = checker.check_molblock(o_molblock)

Note Using SMILES:

from chembl_structure_pipeline import checker

SMILES = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
issues = checker.check_mol_from_smiles(SMILES)

References

[1] Bento, A.P., Hersey, A., Félix, E. et al. An open source chemical structure curation pipeline using RDKit. J Cheminform 12, 51 (2020). https://doi.org/10.1186/s13321-020-00456-1

About

ChEMBL database structure pipelines

License:MIT License


Languages

Language:Python 100.0%